C14H12F3N3O2 — CID 2727185
3-methoxy-N'-[3-(trifluoromethyl)-2-pyridinyl]benzohydrazide (PubChem CID 2727185) has the molecular formula C14H12F3N3O2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 3-methoxy-N'-[3-(trifluoromethyl)-2-pyridinyl]benzohydrazide.
| Compound Name | 3-methoxy-N'-[3-(trifluoromethyl)-2-pyridinyl]benzohydrazide |
|---|---|
| PubChem CID | 2727185 |
| Molecular Formula | C14H12F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-methoxy-N'-[3-(trifluoromethyl)-2-pyridinyl]benzohydrazide |
| SMILES | COc1cccc(C(=O)NNc2ncccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3N3O2/c1-22-10-5-2-4-9(8-10)13(21)20-19-12-11(14(15,16)17)6-3-7-18-12/h2-8H,1H3,(H,18,19)(H,20,21) |
| InChIKey | RYPRQGNTIOYIME-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|