C22H24N4O4S — CID 55692728
N-[[2-(dimethylamino)-3-pyridinyl]methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 55692728) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-3-pyridinyl]methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[[2-(dimethylamino)-3-pyridinyl]methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55692728 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[[2-(dimethylamino)-3-pyridinyl]methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C(=O)NCc3cccnc3N(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O4S/c1-26(2)21-17(5-4-14-23-21)15-24-22(27)16-6-12-20(13-7-16)31(28,29)25-18-8-10-19(30-3)11-9-18/h4-14,25H,15H2,1-3H3,(H,24,27) |
| InChIKey | MQKHOXXZWVVINF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |