C19H23F3N4O4S — CID 55932878
4-methoxy-3-(propan-2-ylsulfamoyl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 55932878) has the molecular formula C19H23F3N4O4S and a molecular weight of 460.48 g/mol. Its IUPAC name is 4-methoxy-3-(propan-2-ylsulfamoyl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | 4-methoxy-3-(propan-2-ylsulfamoyl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55932878 |
| Molecular Formula | C19H23F3N4O4S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-methoxy-3-(propan-2-ylsulfamoyl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNc2ncccc2C(F)(F)F)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C19H23F3N4O4S/c1-12(2)26-31(28,29)16-11-13(6-7-15(16)30-3)18(27)25-10-9-24-17-14(19(20,21)22)5-4-8-23-17/h4-8,11-12,26H,9-10H2,1-3H3,(H,23,24)(H,25,27) |
| InChIKey | QZGSLSJMYUUDGF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|