C17H19F3N4O4S — CID 55933893
3-[methoxy(methyl)sulfamoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 55933893) has the molecular formula C17H19F3N4O4S and a molecular weight of 432.42 g/mol. Its IUPAC name is 3-[methoxy(methyl)sulfamoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | 3-[methoxy(methyl)sulfamoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55933893 |
| Molecular Formula | C17H19F3N4O4S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 3-[methoxy(methyl)sulfamoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)NCCNc2ncccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3N4O4S/c1-24(28-2)29(26,27)13-6-3-5-12(11-13)16(25)23-10-9-22-15-14(17(18,19)20)7-4-8-21-15/h3-8,11H,9-10H2,1-2H3,(H,21,22)(H,23,25) |
| InChIKey | WQBHZMPZMNYTFW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|