C16H22N4O4S — CID 55976049
N-(5-tert-butyl-1H-pyrazol-3-yl)-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 55976049) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(5-tert-butyl-1H-pyrazol-3-yl)-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55976049 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)Nc2cc(C(C)(C)C)[nH]n2)c1 |
| InChI | InChI=1S/C16H22N4O4S/c1-16(2,3)13-10-14(19-18-13)17-15(21)11-7-6-8-12(9-11)25(22,23)20(4)24-5/h6-10H,1-5H3,(H2,17,18,19,21) |
| InChIKey | XTJHSEMYMLUPRO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|