C14H15N3O5S2 — CID 55435386
N-(4-acetyl-1,3-thiazol-2-yl)-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 55435386) has the molecular formula C14H15N3O5S2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55435386 |
| Molecular Formula | C14H15N3O5S2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)Nc2nc(C(C)=O)cs2)c1 |
| InChI | InChI=1S/C14H15N3O5S2/c1-9(18)12-8-23-14(15-12)16-13(19)10-5-4-6-11(7-10)24(20,21)17(2)22-3/h4-8H,1-3H3,(H,15,16,19) |
| InChIKey | NNTXBFWQEMVSDY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|