C15H17N3O3S2 — CID 32864912
N-(4-cyclopropyl-1,3-thiazol-2-yl)-3-(dimethylsulfamoyl)benzamide (PubChem CID 32864912) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 32864912 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-3-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)Nc2nc(C3CC3)cs2)c1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-18(2)23(20,21)12-5-3-4-11(8-12)14(19)17-15-16-13(9-22-15)10-6-7-10/h3-5,8-10H,6-7H2,1-2H3,(H,16,17,19) |
| InChIKey | XOGVADFDAATZIZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |