C17H23N3O3S2 — CID 55903626
3-(dimethylsulfamoyl)-N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)benzamide (PubChem CID 55903626) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55903626 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCCc1nc(NC(=O)c2cccc(S(=O)(=O)N(C)C)c2)sc1CC |
| InChI | InChI=1S/C17H23N3O3S2/c1-5-8-14-15(6-2)24-17(18-14)19-16(21)12-9-7-10-13(11-12)25(22,23)20(3)4/h7,9-11H,5-6,8H2,1-4H3,(H,18,19,21) |
| InChIKey | RNQQXZMSMUJQRY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |