C16H21N3O3S2 — CID 55954055
N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)-4-(methylsulfamoyl)benzamide (PubChem CID 55954055) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)-4-(methylsulfamoyl)benzamide.
| Compound Name | N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55954055 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)-4-(methylsulfamoyl)benzamide |
| SMILES | CCCc1nc(NC(=O)c2ccc(S(=O)(=O)NC)cc2)sc1CC |
| InChI | InChI=1S/C16H21N3O3S2/c1-4-6-13-14(5-2)23-16(18-13)19-15(20)11-7-9-12(10-8-11)24(21,22)17-3/h7-10,17H,4-6H2,1-3H3,(H,18,19,20) |
| InChIKey | ZFBWHLKNCNHCDL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |