C17H20ClN3O3S2 — CID 32865039
2-chloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(diethylsulfamoyl)benzamide (PubChem CID 32865039) has the molecular formula C17H20ClN3O3S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 2-chloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(diethylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 32865039 |
| Molecular Formula | C17H20ClN3O3S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-chloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2nc(C3CC3)cs2)c1 |
| InChI | InChI=1S/C17H20ClN3O3S2/c1-3-21(4-2)26(23,24)12-7-8-14(18)13(9-12)16(22)20-17-19-15(10-25-17)11-5-6-11/h7-11H,3-6H2,1-2H3,(H,19,20,22) |
| InChIKey | LVFIRUPYEGDPLZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |