C12H9Cl2N3OS — CID 32869142
3,6-dichloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)pyridine-2-carboxamide (PubChem CID 32869142) has the molecular formula C12H9Cl2N3OS and a molecular weight of 314.20 g/mol. Its IUPAC name is 3,6-dichloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 32869142 |
| Molecular Formula | C12H9Cl2N3OS |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 3,6-dichloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H9Cl2N3OS/c13-7-3-4-9(14)16-10(7)11(18)17-12-15-8(5-19-12)6-1-2-6/h3-6H,1-2H2,(H,15,17,18) |
| InChIKey | SFTCLBIWRNPGKX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|