C13H9ClF2N2OS — CID 33301577
2-chloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)-4,5-difluorobenzamide (PubChem CID 33301577) has the molecular formula C13H9ClF2N2OS and a molecular weight of 314.74 g/mol. Its IUPAC name is 2-chloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 33301577 |
| Molecular Formula | C13H9ClF2N2OS |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-chloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)-4,5-difluorobenzamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H9ClF2N2OS/c14-8-4-10(16)9(15)3-7(8)12(19)18-13-17-11(5-20-13)6-1-2-6/h3-6H,1-2H2,(H,17,18,19) |
| InChIKey | NVPRTXMPRLZVOJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|