C15H7Cl2F2N3OS — CID 26176305
3,6-dichloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide (PubChem CID 26176305) has the molecular formula C15H7Cl2F2N3OS and a molecular weight of 386.21 g/mol. Its IUPAC name is 3,6-dichloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26176305 |
| Molecular Formula | C15H7Cl2F2N3OS |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 3,6-dichloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)c(F)c2)cs1)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H7Cl2F2N3OS/c16-8-2-4-12(17)21-13(8)14(23)22-15-20-11(6-24-15)7-1-3-9(18)10(19)5-7/h1-6H,(H,20,22,23) |
| InChIKey | MXGOIRVUJILVGO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|