C14H13ClN2OS — CID 32863339
2-(2-chlorophenyl)-N-(4-cyclopropyl-1,3-thiazol-2-yl)acetamide (PubChem CID 32863339) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(4-cyclopropyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-(4-cyclopropyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 32863339 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(4-cyclopropyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccccc1Cl)Nc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C14H13ClN2OS/c15-11-4-2-1-3-10(11)7-13(18)17-14-16-12(8-19-14)9-5-6-9/h1-4,8-9H,5-7H2,(H,16,17,18) |
| InChIKey | XBBWNTJWDVVYPJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |