C16H18FN3O4S2 — CID 55435187
N-(4-acetyl-1,3-thiazol-2-yl)-3-(diethylsulfamoyl)-4-fluorobenzamide (PubChem CID 55435187) has the molecular formula C16H18FN3O4S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-3-(diethylsulfamoyl)-4-fluorobenzamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-(diethylsulfamoyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 55435187 |
| Molecular Formula | C16H18FN3O4S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-(diethylsulfamoyl)-4-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2nc(C(C)=O)cs2)ccc1F |
| InChI | InChI=1S/C16H18FN3O4S2/c1-4-20(5-2)26(23,24)14-8-11(6-7-12(14)17)15(22)19-16-18-13(9-25-16)10(3)21/h6-9H,4-5H2,1-3H3,(H,18,19,22) |
| InChIKey | ZXJOWGMYYBSPQR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |