C21H29FN2O3S — CID 26910714
N-(1-adamantyl)-3-(diethylsulfamoyl)-4-fluorobenzamide (PubChem CID 26910714) has the molecular formula C21H29FN2O3S and a molecular weight of 408.54 g/mol. Its IUPAC name is N-(1-adamantyl)-3-(diethylsulfamoyl)-4-fluorobenzamide.
| Compound Name | N-(1-adamantyl)-3-(diethylsulfamoyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 26910714 |
| Molecular Formula | C21H29FN2O3S |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-(1-adamantyl)-3-(diethylsulfamoyl)-4-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)ccc1F |
| InChI | InChI=1S/C21H29FN2O3S/c1-3-24(4-2)28(26,27)19-10-17(5-6-18(19)22)20(25)23-21-11-14-7-15(12-21)9-16(8-14)13-21/h5-6,10,14-16H,3-4,7-9,11-13H2,1-2H3,(H,23,25) |
| InChIKey | YCNFAGADYBBJEZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |