C17H23N3O2S3 — CID 9341593
N-[2-(4-tert-butylphenoxy)ethyl]-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 9341593) has the molecular formula C17H23N3O2S3 and a molecular weight of 397.59 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 9341593 |
| Molecular Formula | C17H23N3O2S3 |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CSc1nnc(SCC(=O)NCCOc2ccc(C(C)(C)C)cc2)s1 |
| InChI | InChI=1S/C17H23N3O2S3/c1-17(2,3)12-5-7-13(8-6-12)22-10-9-18-14(21)11-24-16-20-19-15(23-4)25-16/h5-8H,9-11H2,1-4H3,(H,18,21) |
| InChIKey | HRIVORWHLCUAAO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|