C11H20F2N2O2S — CID 114127743
2-carbamothioyl-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethylbutanamide (PubChem CID 114127743) has the molecular formula C11H20F2N2O2S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-carbamothioyl-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethylbutanamide.
| Compound Name | 2-carbamothioyl-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 114127743 |
| Molecular Formula | C11H20F2N2O2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-carbamothioyl-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)(C(=O)NCCOCC(F)F)C(N)=S |
| InChI | InChI=1S/C11H20F2N2O2S/c1-3-11(4-2,9(14)18)10(16)15-5-6-17-7-8(12)13/h8H,3-7H2,1-2H3,(H2,14,18)(H,15,16) |
| InChIKey | BLFRWQSEMQJFGG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|