C9H21N3O3S — CID 106337531
3-amino-N-[2-(dimethylsulfamoyl)ethyl]-3-methylbutanamide (PubChem CID 106337531) has the molecular formula C9H21N3O3S and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-amino-N-[2-(dimethylsulfamoyl)ethyl]-3-methylbutanamide.
| Compound Name | 3-amino-N-[2-(dimethylsulfamoyl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106337531 |
| Molecular Formula | C9H21N3O3S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-amino-N-[2-(dimethylsulfamoyl)ethyl]-3-methylbutanamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)CC(C)(C)N |
| InChI | InChI=1S/C9H21N3O3S/c1-9(2,10)7-8(13)11-5-6-16(14,15)12(3)4/h5-7,10H2,1-4H3,(H,11,13) |
| InChIKey | CFZYXFSQOUXNEO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |