C30H44O2 — CID 158821892
acetylene;(3E,5E)-6,10-dimethylundeca-3,5,9-trien-2-one;(4E,6E)-3,7,11-trimethyldodeca-4,6,10-trien-1-yn-3-ol (PubChem CID 158821892) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is acetylene;(3E,5E)-6,10-dimethylundeca-3,5,9-trien-2-one;(4E,6E)-3,7,11-trimethyldodeca-4,6,10-trien-1-yn-3-ol.
| Compound Name | acetylene;(3E,5E)-6,10-dimethylundeca-3,5,9-trien-2-one;(4E,6E)-3,7,11-trimethyldodeca-4,6,10-trien-1-yn-3-ol |
|---|---|
| PubChem CID | 158821892 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | acetylene;(3E,5E)-6,10-dimethylundeca-3,5,9-trien-2-one;(4E,6E)-3,7,11-trimethyldodeca-4,6,10-trien-1-yn-3-ol |
| SMILES | C#C.C#CC(C)(O)/C=C/C=C(\C)CCC=C(C)C.CC(=O)/C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H22O.C13H20O.C2H2/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3;1-11(2)7-5-8-12(3)9-6-10-13(4)14;1-2/h1,8-9,11-12,16H,7,10H2,2-5H3;6-7,9-10H,5,8H2,1-4H3;1-2H/b12-8+,14-11+;10-6+,12-9+; |
| InChIKey | IVYZDPBOZYUOCY-NEKABMEMSA-N |
| XLogP | 7.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|