C16H24O — CID 20732946
(5E,7E)-4,8,12-trimethyltrideca-5,7,11-trien-1-yn-4-ol (PubChem CID 20732946) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (5E,7E)-4,8,12-trimethyltrideca-5,7,11-trien-1-yn-4-ol.
| Compound Name | (5E,7E)-4,8,12-trimethyltrideca-5,7,11-trien-1-yn-4-ol |
|---|---|
| PubChem CID | 20732946 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (5E,7E)-4,8,12-trimethyltrideca-5,7,11-trien-1-yn-4-ol |
| SMILES | C#CCC(C)(O)/C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H24O/c1-6-12-16(5,17)13-8-11-15(4)10-7-9-14(2)3/h1,8-9,11,13,17H,7,10,12H2,2-5H3/b13-8+,15-11+ |
| InChIKey | HTGHKLDVJVAVMI-ZSDFXZAOSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|