C34H53O4P — CID 159188188
(4E,6E)-1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,2,4,6,10-pentaene;(4E,6E)-3,7,11-trimethyldodeca-4,6,10-trien-1-yn-3-ol (PubChem CID 159188188) has the molecular formula C34H53O4P and a molecular weight of 556.77 g/mol. Its IUPAC name is (4E,6E)-1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,2,4,6,10-pentaene;(4E,6E)-3,7,11-trimethyldodeca-4,6,10-trien-1-yn-3-ol.
| Compound Name | (4E,6E)-1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,2,4,6,10-pentaene;(4E,6E)-3,7,11-trimethyldodeca-4,6,10-trien-1-yn-3-ol |
|---|---|
| PubChem CID | 159188188 |
| Molecular Formula | C34H53O4P |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | (4E,6E)-1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,2,4,6,10-pentaene;(4E,6E)-3,7,11-trimethyldodeca-4,6,10-trien-1-yn-3-ol |
| SMILES | C#CC(C)(O)/C=C/C=C(\C)CCC=C(C)C.CCOP(=O)(C=C=C(C)/C=C/C=C(\C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C19H31O3P.C15H22O/c1-7-21-23(20,22-8-2)16-15-19(6)14-10-13-18(5)12-9-11-17(3)4;1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h10-11,13-14,16H,7-9,12H2,1-6H3;1,8-9,11-12,16H,7,10H2,2-5H3/b14-10+,18-13+;12-8+,14-11+ |
| InChIKey | KNTGDOFIWHJQQV-WRJMDDLHSA-N |
| XLogP | 10.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|