C21H38O2 — CID 144649738
10,10-di(butan-2-yloxy)-2,6-dimethylundeca-2,6,8-triene (PubChem CID 144649738) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 10,10-di(butan-2-yloxy)-2,6-dimethylundeca-2,6,8-triene.
| Compound Name | 10,10-di(butan-2-yloxy)-2,6-dimethylundeca-2,6,8-triene |
|---|---|
| PubChem CID | 144649738 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | 10,10-di(butan-2-yloxy)-2,6-dimethylundeca-2,6,8-triene |
| SMILES | CCC(C)OC(C)(C=CC=C(C)CCC=C(C)C)OC(C)CC |
| InChI | InChI=1S/C21H38O2/c1-9-19(6)22-21(8,23-20(7)10-2)16-12-15-18(5)14-11-13-17(3)4/h12-13,15-16,19-20H,9-11,14H2,1-8H3 |
| InChIKey | VEQOUILMFBWCFZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|