C14H21F3O — CID 177425509
(3Z,5E)-1,1,1-trifluoro-2,6,10-trimethylundeca-3,5,9-trien-2-ol (PubChem CID 177425509) has the molecular formula C14H21F3O and a molecular weight of 262.31 g/mol. Its IUPAC name is (3Z,5E)-1,1,1-trifluoro-2,6,10-trimethylundeca-3,5,9-trien-2-ol.
| Compound Name | (3Z,5E)-1,1,1-trifluoro-2,6,10-trimethylundeca-3,5,9-trien-2-ol |
|---|---|
| PubChem CID | 177425509 |
| Molecular Formula | C14H21F3O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (3Z,5E)-1,1,1-trifluoro-2,6,10-trimethylundeca-3,5,9-trien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/C=C\C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C14H21F3O/c1-11(2)7-5-8-12(3)9-6-10-13(4,18)14(15,16)17/h6-7,9-10,18H,5,8H2,1-4H3/b10-6-,12-9+ |
| InChIKey | DUTWCQWADRNRAE-ZQNGMKBSSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|