About (E)-7-oxohept-2-enamide
(E)-7-oxohept-2-enamide (PubChem CID 153402792) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is (E)-7-oxohept-2-enamide.
Molecular Properties
| Compound Name | (E)-7-oxohept-2-enamide |
| PubChem CID | 153402792 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (E)-7-oxohept-2-enamide |
| SMILES | NC(=O)/C=C/CCCC=O |
| InChI | InChI=1S/C7H11NO2/c8-7(10)5-3-1-2-4-6-9/h3,5-6H,1-2,4H2,(H2,8,10)/b5-3+ |
| InChIKey | VBTGJSCDGNNQAJ-HWKANZROSA-N |
| XLogP | 0.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-oxohept-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-oxohept-2-enamide?
The IUPAC name of (E)-7-oxohept-2-enamide (CID 153402792) is (E)-7-oxohept-2-enamide.
What is the SMILES notation for (E)-7-oxohept-2-enamide?
The canonical SMILES for (E)-7-oxohept-2-enamide is NC(=O)/C=C/CCCC=O.
What is the InChIKey of (E)-7-oxohept-2-enamide?
The InChIKey is VBTGJSCDGNNQAJ-HWKANZROSA-N. The full InChI is InChI=1S/C7H11NO2/c8-7(10)5-3-1-2-4-6-9/h3,5-6H,1-2,4H2,(H2,8,10)/b5-3+.
What are the key properties of (E)-7-oxohept-2-enamide?
(E)-7-oxohept-2-enamide has a molecular weight of 141.17 g/mol, XLogP of 0.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-oxohept-2-enamide is sourced from PubChem (CID 153402792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).