C8H12N2O3 — CID 173137531
3-hydroxyocta-2,6-dienediamide (PubChem CID 173137531) has the molecular formula C8H12N2O3 and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-hydroxyocta-2,6-dienediamide.
| Compound Name | 3-hydroxyocta-2,6-dienediamide |
|---|---|
| PubChem CID | 173137531 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-hydroxyocta-2,6-dienediamide |
| SMILES | NC(=O)C=CCCC(O)=CC(N)=O |
| InChI | InChI=1S/C8H12N2O3/c9-7(12)4-2-1-3-6(11)5-8(10)13/h2,4-5,11H,1,3H2,(H2,9,12)(H2,10,13) |
| InChIKey | FUHWMWIULVMYTM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|