About 3-hydroxyocta-2,6-dienediamide
3-hydroxyocta-2,6-dienediamide (PubChem CID 173137531) has the molecular formula C8H12N2O3
and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-hydroxyocta-2,6-dienediamide.
Molecular Properties
| Compound Name | 3-hydroxyocta-2,6-dienediamide |
| PubChem CID | 173137531 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-hydroxyocta-2,6-dienediamide |
| SMILES | NC(=O)C=CCCC(O)=CC(N)=O |
| InChI | InChI=1S/C8H12N2O3/c9-7(12)4-2-1-3-6(11)5-8(10)13/h2,4-5,11H,1,3H2,(H2,9,12)(H2,10,13) |
| InChIKey | FUHWMWIULVMYTM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyocta-2,6-dienediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyocta-2,6-dienediamide?
The IUPAC name of 3-hydroxyocta-2,6-dienediamide (CID 173137531) is 3-hydroxyocta-2,6-dienediamide.
What is the SMILES notation for 3-hydroxyocta-2,6-dienediamide?
The canonical SMILES for 3-hydroxyocta-2,6-dienediamide is NC(=O)C=CCCC(O)=CC(N)=O.
What is the InChIKey of 3-hydroxyocta-2,6-dienediamide?
The InChIKey is FUHWMWIULVMYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c9-7(12)4-2-1-3-6(11)5-8(10)13/h2,4-5,11H,1,3H2,(H2,9,12)(H2,10,13).
What are the key properties of 3-hydroxyocta-2,6-dienediamide?
3-hydroxyocta-2,6-dienediamide has a molecular weight of 184.20 g/mol, XLogP of -0.26, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyocta-2,6-dienediamide is sourced from PubChem (CID 173137531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).