C27H44N2O — CID 10295188
(5E,8E,11E,14E,17E)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 10295188) has the molecular formula C27H44N2O and a molecular weight of 412.66 g/mol. Its IUPAC name is (5E,8E,11E,14E,17E)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5E,8E,11E,14E,17E)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 10295188 |
| Molecular Formula | C27H44N2O |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.35 |
| IUPAC Name | (5E,8E,11E,14E,17E)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)NCCC1CCCN1C |
| InChI | InChI=1S/C27H44N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-27(30)28-24-23-26-21-20-25-29(26)2/h4-5,7-8,10-11,13-14,16-17,26H,3,6,9,12,15,18-25H2,1-2H3,(H,28,30)/b5-4+,8-7+,11-10+,14-13+,17-16+ |
| InChIKey | WWIPMLLDKIWIOO-ZACMJQCDSA-N |
| XLogP | 6.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|