C32H52N2O2S4 — CID 140612582
(5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 140612582) has the molecular formula C32H52N2O2S4 and a molecular weight of 625.05 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 140612582 |
| Molecular Formula | C32H52N2O2S4 |
| Molecular Weight | 625.05 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCSSCCNC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C32H52N2O2S4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-31(35)33-25-28-37-38-29-26-34-32(36)23-20-19-21-30-24-27-39-40-30/h3-4,6-7,9-10,12-13,15-16,30H,2,5,8,11,14,17-29H2,1H3,(H,33,35)(H,34,36)/b4-3-,7-6-,10-9-,13-12-,16-15-/t30-/m1/s1 |
| InChIKey | DESCOCGHWXMTHL-ZWQJVOMCSA-N |
| XLogP | 9.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.05 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|