C34H52N4O3S — CID 90071135
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 90071135) has the molecular formula C34H52N4O3S and a molecular weight of 596.88 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 90071135 |
| Molecular Formula | C34H52N4O3S |
| Molecular Weight | 596.88 g/mol |
| Exact Mass | 596.38 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C34H52N4O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-31(39)35-26-27-36-32(40)25-22-21-23-30-33-29(28-42-30)37-34(41)38-33/h3-4,6-7,9-10,12-13,15-16,18-19,29-30,33H,2,5,8,11,14,17,20-28H2,1H3,(H,35,39)(H,36,40)(H2,37,38,41)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-/t29-,30-,33-/m0/s1 |
| InChIKey | YFHILEYULGONTN-CADYORLXSA-N |
| XLogP | 6.42 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.88 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|