C29H57N4O6S3+ — CID 118198979
3-[[5-[3-[5-(dithiolan-3-yl)pentanoylamino]propylamino]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 118198979) has the molecular formula C29H57N4O6S3+ and a molecular weight of 654.00 g/mol. Its IUPAC name is 3-[[5-[3-[5-(dithiolan-3-yl)pentanoylamino]propylamino]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[[5-[3-[5-(dithiolan-3-yl)pentanoylamino]propylamino]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 118198979 |
| Molecular Formula | C29H57N4O6S3+ |
| Molecular Weight | 654.00 g/mol |
| Exact Mass | 653.34 |
| IUPAC Name | 3-[[5-[3-[5-(dithiolan-3-yl)pentanoylamino]propylamino]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | CCC(C)(CC(C)(C)C(=O)NCCCNC(=O)CCCCC1CCSS1)C(=O)NCCC[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C29H56N4O6S3/c1-7-29(4,27(36)32-18-11-19-33(5,6)20-12-22-42(37,38)39)23-28(2,3)26(35)31-17-10-16-30-25(34)14-9-8-13-24-15-21-40-41-24/h24H,7-23H2,1-6H3,(H3-,30,31,32,34,35,36,37,38,39)/p+1 |
| InChIKey | DQSNBIVAAULXHM-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.00 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|