C14H20N2O4S2 — CID 8506554
[2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate (PubChem CID 8506554) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate.
| Compound Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
|---|---|
| PubChem CID | 8506554 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)COC(=O)CSCc1cccs1 |
| InChI | InChI=1S/C14H20N2O4S2/c1-3-10(2)15-14(19)16-12(17)7-20-13(18)9-21-8-11-5-4-6-22-11/h4-6,10H,3,7-9H2,1-2H3,(H2,15,16,17,19)/t10-/m1/s1 |
| InChIKey | YBLIWHFKNFUUFZ-SNVBAGLBSA-N |
| XLogP | 2.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |