C21H22N2O5 — CID 8014002
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 8014002) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 8014002 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | CC[C@H](C)NC(=O)NC(=O)COC(=O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C21H22N2O5/c1-3-13(2)22-21(26)23-18(24)12-27-20(25)19-14-8-4-6-10-16(14)28-17-11-7-5-9-15(17)19/h4-11,13,19H,3,12H2,1-2H3,(H2,22,23,24,26)/t13-/m0/s1 |
| InChIKey | PPBBKVXKIHNSKL-ZDUSSCGKSA-N |
| XLogP | 3.09 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |