C23H25NO6 — CID 9201548
[2-[[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 9201548) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is [2-[[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-[[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 9201548 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | [2-[[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)COC(=O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C23H25NO6/c1-14(2)12-17(22(26)28-3)24-20(25)13-29-23(27)21-15-8-4-6-10-18(15)30-19-11-7-5-9-16(19)21/h4-11,14,17,21H,12-13H2,1-3H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | ZAUBGSZVFFNLNY-KRWDZBQOSA-N |
| XLogP | 3.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |