C22H15F2NO4 — CID 3929613
[2-(2,5-difluoroanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 3929613) has the molecular formula C22H15F2NO4 and a molecular weight of 395.36 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 3929613 |
| Molecular Formula | C22H15F2NO4 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | O=C(COC(=O)C1c2ccccc2Oc2ccccc21)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C22H15F2NO4/c23-13-9-10-16(24)17(11-13)25-20(26)12-28-22(27)21-14-5-1-3-7-18(14)29-19-8-4-2-6-15(19)21/h1-11,21H,12H2,(H,25,26) |
| InChIKey | UXVZJRSXMUBKDT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |