C29H21NO5 — CID 3575554
[2-(2-benzoylanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 3575554) has the molecular formula C29H21NO5 and a molecular weight of 463.49 g/mol. Its IUPAC name is [2-(2-benzoylanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-(2-benzoylanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 3575554 |
| Molecular Formula | C29H21NO5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [2-(2-benzoylanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | O=C(COC(=O)C1c2ccccc2Oc2ccccc21)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H21NO5/c31-26(30-23-15-7-4-12-20(23)28(32)19-10-2-1-3-11-19)18-34-29(33)27-21-13-5-8-16-24(21)35-25-17-9-6-14-22(25)27/h1-17,27H,18H2,(H,30,31) |
| InChIKey | JGWZRRNAINZESK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |