C26H25NO4 — CID 7716805
[2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 7716805) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 7716805 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)COC(=O)C2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C26H25NO4/c1-3-17(2)18-12-14-19(15-13-18)27-24(28)16-30-26(29)25-20-8-4-6-10-22(20)31-23-11-7-5-9-21(23)25/h4-15,17,25H,3,16H2,1-2H3,(H,27,28)/t17-/m1/s1 |
| InChIKey | FJXDHIZIZROMOG-QGZVFWFLSA-N |
| XLogP | 5.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |