C25H18N2O6 — CID 32690162
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 32690162) has the molecular formula C25H18N2O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 32690162 |
| Molecular Formula | C25H18N2O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | CN1C(=O)c2ccc(NC(=O)COC(=O)C3c4ccccc4Oc4ccccc43)cc2C1=O |
| InChI | InChI=1S/C25H18N2O6/c1-27-23(29)15-11-10-14(12-18(15)24(27)30)26-21(28)13-32-25(31)22-16-6-2-4-8-19(16)33-20-9-5-3-7-17(20)22/h2-12,22H,13H2,1H3,(H,26,28) |
| InChIKey | DJLYZZCRJRWGPY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|