C22H16N2O6 — CID 38904459
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-phenylfuran-2-carboxylate (PubChem CID 38904459) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-phenylfuran-2-carboxylate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-phenylfuran-2-carboxylate |
|---|---|
| PubChem CID | 38904459 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-phenylfuran-2-carboxylate |
| SMILES | CN1C(=O)c2ccc(NC(=O)COC(=O)c3occc3-c3ccccc3)cc2C1=O |
| InChI | InChI=1S/C22H16N2O6/c1-24-20(26)16-8-7-14(11-17(16)21(24)27)23-18(25)12-30-22(28)19-15(9-10-29-19)13-5-3-2-4-6-13/h2-11H,12H2,1H3,(H,23,25) |
| InChIKey | UTUUBGWZWGUWDG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|