C24H19N3O7 — CID 55547063
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-2-phenylacetate (PubChem CID 55547063) has the molecular formula C24H19N3O7 and a molecular weight of 461.43 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-2-phenylacetate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-2-phenylacetate |
|---|---|
| PubChem CID | 55547063 |
| Molecular Formula | C24H19N3O7 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-2-phenylacetate |
| SMILES | CN1C(=O)c2ccc(NC(=O)COC(=O)C(NC(=O)c3ccco3)c3ccccc3)cc2C1=O |
| InChI | InChI=1S/C24H19N3O7/c1-27-22(30)16-10-9-15(12-17(16)23(27)31)25-19(28)13-34-24(32)20(14-6-3-2-4-7-14)26-21(29)18-8-5-11-33-18/h2-12,20H,13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | WLJHEQIQQIMCJR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|