C20H17BrN2O6 — CID 55378617
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(4-bromophenoxy)propanoate (PubChem CID 55378617) has the molecular formula C20H17BrN2O6 and a molecular weight of 461.27 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(4-bromophenoxy)propanoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(4-bromophenoxy)propanoate |
|---|---|
| PubChem CID | 55378617 |
| Molecular Formula | C20H17BrN2O6 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 2-(4-bromophenoxy)propanoate |
| SMILES | CC(Oc1ccc(Br)cc1)C(=O)OCC(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C20H17BrN2O6/c1-11(29-14-6-3-12(21)4-7-14)20(27)28-10-17(24)22-13-5-8-15-16(9-13)19(26)23(2)18(15)25/h3-9,11H,10H2,1-2H3,(H,22,24) |
| InChIKey | PQZIZMOGWGNDOU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|