C26H21NO7 — CID 46509920
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 2-(4-methoxyphenoxy)propanoate (PubChem CID 46509920) has the molecular formula C26H21NO7 and a molecular weight of 459.45 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 2-(4-methoxyphenoxy)propanoate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 2-(4-methoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 46509920 |
| Molecular Formula | C26H21NO7 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 2-(4-methoxyphenoxy)propanoate |
| SMILES | COc1ccc(OC(C)C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H21NO7/c1-15(34-18-10-8-17(32-2)9-11-18)26(31)33-14-23(28)27-16-7-12-21-22(13-16)25(30)20-6-4-3-5-19(20)24(21)29/h3-13,15H,14H2,1-2H3,(H,27,28) |
| InChIKey | VTEOGXFWYZGNDZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|