C23H22N2O6S — CID 46641233
[2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 3-phenylfuran-2-carboxylate (PubChem CID 46641233) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 3-phenylfuran-2-carboxylate.
| Compound Name | [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 3-phenylfuran-2-carboxylate |
|---|---|
| PubChem CID | 46641233 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 3-phenylfuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1occc1-c1ccccc1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C23H22N2O6S/c26-21(16-31-23(27)22-20(11-14-30-22)17-7-2-1-3-8-17)24-18-9-6-10-19(15-18)32(28,29)25-12-4-5-13-25/h1-3,6-11,14-15H,4-5,12-13,16H2,(H,24,26) |
| InChIKey | BHJRSQMIZFSSMJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |