C23H18BrNO4 — CID 2391827
[2-(2-bromo-4-methylanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 2391827) has the molecular formula C23H18BrNO4 and a molecular weight of 452.30 g/mol. Its IUPAC name is [2-(2-bromo-4-methylanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 2391827 |
| Molecular Formula | C23H18BrNO4 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C2c3ccccc3Oc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C23H18BrNO4/c1-14-10-11-18(17(24)12-14)25-21(26)13-28-23(27)22-15-6-2-4-8-19(15)29-20-9-5-3-7-16(20)22/h2-12,22H,13H2,1H3,(H,25,26) |
| InChIKey | AKBCEMIOBBINEW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |