C24H20N2O4 — CID 7977850
[2-oxo-2-(4-phenylanilino)ethyl] (2S)-2-(4-cyanophenoxy)propanoate (PubChem CID 7977850) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylanilino)ethyl] (2S)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-oxo-2-(4-phenylanilino)ethyl] (2S)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7977850 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [2-oxo-2-(4-phenylanilino)ethyl] (2S)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)OCC(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O4/c1-17(30-22-13-7-18(15-25)8-14-22)24(28)29-16-23(27)26-21-11-9-20(10-12-21)19-5-3-2-4-6-19/h2-14,17H,16H2,1H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | PZKOQZNLPUIVMW-KRWDZBQOSA-N |
| XLogP | 4.17 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |