C23H25N3O4 — CID 7762118
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (2S)-2-(4-cyanophenoxy)propanoate (PubChem CID 7762118) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (2S)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (2S)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7762118 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (2S)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)OCC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-17(30-21-11-5-18(15-24)6-12-21)23(28)29-16-22(27)25-19-7-9-20(10-8-19)26-13-3-2-4-14-26/h5-12,17H,2-4,13-14,16H2,1H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | FCAALRFVSDJZEM-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|