C19H18N2O4 — CID 8938076
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] (2R)-2-phenoxypropanoate (PubChem CID 8938076) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] (2R)-2-phenoxypropanoate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] (2R)-2-phenoxypropanoate |
|---|---|
| PubChem CID | 8938076 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] (2R)-2-phenoxypropanoate |
| SMILES | C[C@@H](Oc1ccccc1)C(=O)OCC(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C19H18N2O4/c1-14(25-17-5-3-2-4-6-17)19(23)24-13-18(22)21-16-9-7-15(8-10-16)11-12-20/h2-10,14H,11,13H2,1H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | OPCCVHMBIBZJLP-CQSZACIVSA-N |
| XLogP | 2.70 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |