C20H20N2O3 — CID 9060900
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-methyl-2-phenylpropanoate (PubChem CID 9060900) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-methyl-2-phenylpropanoate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 9060900 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-methyl-2-phenylpropanoate |
| SMILES | CC(C)(C(=O)OCC(=O)Nc1ccc(CC#N)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c1-20(2,16-6-4-3-5-7-16)19(24)25-14-18(23)22-17-10-8-15(9-11-17)12-13-21/h3-11H,12,14H2,1-2H3,(H,22,23) |
| InChIKey | NUMLGJLTIGZGHM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |