C20H18N2O3 — CID 8951289
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate (PubChem CID 8951289) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 8951289 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate |
| SMILES | N#CCc1ccc(NC(=O)COC(=O)C2(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H18N2O3/c21-13-10-15-6-8-17(9-7-15)22-18(23)14-25-19(24)20(11-12-20)16-4-2-1-3-5-16/h1-9H,10-12,14H2,(H,22,23) |
| InChIKey | QBSFNGJDJAEEFD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |