C16H14ClN3O4 — CID 2348332
[2-(4-carbamoylanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 2348332) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 2348332 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)c2ccc(Cl)cc2N)cc1 |
| InChI | InChI=1S/C16H14ClN3O4/c17-10-3-6-12(13(18)7-10)16(23)24-8-14(21)20-11-4-1-9(2-5-11)15(19)22/h1-7H,8,18H2,(H2,19,22)(H,20,21) |
| InChIKey | IYMCRBASFXHVAP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|