C19H20ClNO7S — CID 30033969
[2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-(2-methoxy-4-methylphenoxy)acetate (PubChem CID 30033969) has the molecular formula C19H20ClNO7S and a molecular weight of 441.89 g/mol. Its IUPAC name is [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-(2-methoxy-4-methylphenoxy)acetate.
| Compound Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-(2-methoxy-4-methylphenoxy)acetate |
|---|---|
| PubChem CID | 30033969 |
| Molecular Formula | C19H20ClNO7S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-(2-methoxy-4-methylphenoxy)acetate |
| SMILES | COc1cc(C)ccc1OCC(=O)OCC(=O)Nc1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C19H20ClNO7S/c1-12-4-7-16(17(8-12)26-2)27-11-19(23)28-10-18(22)21-15-9-13(29(3,24)25)5-6-14(15)20/h4-9H,10-11H2,1-3H3,(H,21,22) |
| InChIKey | DFQRKUXEHGSZJP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |